C26H22N4O — CID 50912868
[6-(2-phenylethynyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(4-phenylpiperidin-1-yl)methanone (PubChem CID 50912868) has the molecular formula C26H22N4O and a molecular weight of 406.49 g/mol. Its IUPAC name is [6-(2-phenylethynyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(4-phenylpiperidin-1-yl)methanone.
| Compound Name | [6-(2-phenylethynyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 50912868 |
| Molecular Formula | C26H22N4O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [6-(2-phenylethynyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cc2ncc(C#Cc3ccccc3)cn2n1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H22N4O/c31-26(29-15-13-23(14-16-29)22-9-5-2-6-10-22)24-17-25-27-18-21(19-30(25)28-24)12-11-20-7-3-1-4-8-20/h1-10,17-19,23H,13-16H2 |
| InChIKey | IRTCUOSJQSCNCA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|