C20H30O3 — CID 50916401
(1R,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-5-one (PubChem CID 50916401) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-5-one.
| Compound Name | (1R,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-5-one |
|---|---|
| PubChem CID | 50916401 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,7,8-tetrahydroazulene-3,2'-1,3-dioxolane]-5-one |
| SMILES | C=CC[C@]1(C)CC[C@@]2(C)C(=CC1=O)C1(C[C@@H]2C(C)C)OCCO1 |
| InChI | InChI=1S/C20H30O3/c1-6-7-18(4)8-9-19(5)15(14(2)3)13-20(22-10-11-23-20)16(19)12-17(18)21/h6,12,14-15H,1,7-11,13H2,2-5H3/t15-,18-,19-/m1/s1 |
| InChIKey | IHSSMZSLGLLHBZ-ATZDWAIDSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|