C18H18O3 — CID 50923469
3-(7-butylbenzo[g][1,3]benzodioxol-8-yl)prop-2-yn-1-ol (PubChem CID 50923469) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(7-butylbenzo[g][1,3]benzodioxol-8-yl)prop-2-yn-1-ol.
| Compound Name | 3-(7-butylbenzo[g][1,3]benzodioxol-8-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 50923469 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(7-butylbenzo[g][1,3]benzodioxol-8-yl)prop-2-yn-1-ol |
| SMILES | CCCCc1cc2ccc3c(c2cc1C#CCO)OCO3 |
| InChI | InChI=1S/C18H18O3/c1-2-3-5-13-10-15-7-8-17-18(21-12-20-17)16(15)11-14(13)6-4-9-19/h7-8,10-11,19H,2-3,5,9,12H2,1H3 |
| InChIKey | WIILGLYSLBFMPE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|