C30H33NO5SSi — CID 50936633
4-methyl-N-[2-[5-(oxan-2-yloxymethyl)furan-2-yl]ethynyl]-N-[2-(2-trimethylsilylethynyl)phenyl]benzenesulfonamide (PubChem CID 50936633) has the molecular formula C30H33NO5SSi and a molecular weight of 547.75 g/mol. Its IUPAC name is 4-methyl-N-[2-[5-(oxan-2-yloxymethyl)furan-2-yl]ethynyl]-N-[2-(2-trimethylsilylethynyl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[5-(oxan-2-yloxymethyl)furan-2-yl]ethynyl]-N-[2-(2-trimethylsilylethynyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 50936633 |
| Molecular Formula | C30H33NO5SSi |
| Molecular Weight | 547.75 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 4-methyl-N-[2-[5-(oxan-2-yloxymethyl)furan-2-yl]ethynyl]-N-[2-(2-trimethylsilylethynyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#Cc2ccc(COC3CCCCO3)o2)c2ccccc2C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C30H33NO5SSi/c1-24-12-16-28(17-13-24)37(32,33)31(29-10-6-5-9-25(29)19-22-38(2,3)4)20-18-26-14-15-27(36-26)23-35-30-11-7-8-21-34-30/h5-6,9-10,12-17,30H,7-8,11,21,23H2,1-4H3 |
| InChIKey | MBZRAROVAAKNGN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|