C21H28N2O — CID 50938190
(E)-N-butyl-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-phenylprop-2-enamide (PubChem CID 50938190) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (E)-N-butyl-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-butyl-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 50938190 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (E)-N-butyl-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-phenylprop-2-enamide |
| SMILES | CCCCN(C(=O)/C=C/c1ccccc1)C1=C[C@H]2CC[C@H](C1)N2C |
| InChI | InChI=1S/C21H28N2O/c1-3-4-14-23(20-15-18-11-12-19(16-20)22(18)2)21(24)13-10-17-8-6-5-7-9-17/h5-10,13,15,18-19H,3-4,11-12,14,16H2,1-2H3/b13-10+/t18-,19-/m1/s1 |
| InChIKey | JIKAVSKPMLXRKC-LIVJGKJPSA-N |
| XLogP | 4.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|