About N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide
N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide (PubChem CID 91140325) has the molecular formula C20H26N2O3
and a molecular weight of 342.44 g/mol. Its IUPAC name is N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide.
Molecular Properties
| Compound Name | N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide |
| PubChem CID | 91140325 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide |
| SMILES | CCCCN(C(=O)C=Cc1ccccc1)c1cc(O)n(CCC)c1O |
| InChI | InChI=1S/C20H26N2O3/c1-3-5-14-21(17-15-19(24)22(13-4-2)20(17)25)18(23)12-11-16-9-7-6-8-10-16/h6-12,15,24-25H,3-5,13-14H2,1-2H3 |
| InChIKey | UTOGHHWFKHZRNT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide?
The IUPAC name of N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide (CID 91140325) is N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide.
What is the SMILES notation for N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide?
The canonical SMILES for N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide is CCCCN(C(=O)C=Cc1ccccc1)c1cc(O)n(CCC)c1O.
What is the InChIKey of N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide?
The InChIKey is UTOGHHWFKHZRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O3/c1-3-5-14-21(17-15-19(24)22(13-4-2)20(17)25)18(23)12-11-16-9-7-6-8-10-16/h6-12,15,24-25H,3-5,13-14H2,1-2H3.
What are the key properties of N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide?
N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide has a molecular weight of 342.44 g/mol, XLogP of 4.16, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)-3-phenylprop-2-enamide is sourced from PubChem (CID 91140325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).