C12H21NOS2 — CID 50940530
[(1S,9aR)-spiro[1,3,4,6,7,8,9,9a-octahydroquinolizine-2,2'-1,3-dithiolane]-1-yl]methanol (PubChem CID 50940530) has the molecular formula C12H21NOS2 and a molecular weight of 259.44 g/mol. Its IUPAC name is [(1S,9aR)-spiro[1,3,4,6,7,8,9,9a-octahydroquinolizine-2,2'-1,3-dithiolane]-1-yl]methanol.
| Compound Name | [(1S,9aR)-spiro[1,3,4,6,7,8,9,9a-octahydroquinolizine-2,2'-1,3-dithiolane]-1-yl]methanol |
|---|---|
| PubChem CID | 50940530 |
| Molecular Formula | C12H21NOS2 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | [(1S,9aR)-spiro[1,3,4,6,7,8,9,9a-octahydroquinolizine-2,2'-1,3-dithiolane]-1-yl]methanol |
| SMILES | OC[C@@H]1[C@H]2CCCCN2CCC12SCCS2 |
| InChI | InChI=1S/C12H21NOS2/c14-9-10-11-3-1-2-5-13(11)6-4-12(10)15-7-8-16-12/h10-11,14H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | ZEOPQPNXEQZBEJ-GHMZBOCLSA-N |
| XLogP | 2.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |