C45H36N2O2S — CID 50942077
1,3-dibenzyl-5-(4-methylsulfanylphenyl)-2-phenyl-4-[4-(2-phenylethynyl)phenyl]-4H-imidazol-3-ium-5-carboxylate (PubChem CID 50942077) has the molecular formula C45H36N2O2S and a molecular weight of 668.86 g/mol. Its IUPAC name is 1,3-dibenzyl-5-(4-methylsulfanylphenyl)-2-phenyl-4-[4-(2-phenylethynyl)phenyl]-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1,3-dibenzyl-5-(4-methylsulfanylphenyl)-2-phenyl-4-[4-(2-phenylethynyl)phenyl]-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 50942077 |
| Molecular Formula | C45H36N2O2S |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 1,3-dibenzyl-5-(4-methylsulfanylphenyl)-2-phenyl-4-[4-(2-phenylethynyl)phenyl]-4H-imidazol-3-ium-5-carboxylate |
| SMILES | CSc1ccc(C2(C(=O)[O-])C(c3ccc(C#Cc4ccccc4)cc3)[N+](Cc3ccccc3)=C(c3ccccc3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C45H36N2O2S/c1-50-41-30-28-40(29-31-41)45(44(48)49)42(38-26-24-35(25-27-38)23-22-34-14-6-2-7-15-34)46(32-36-16-8-3-9-17-36)43(39-20-12-5-13-21-39)47(45)33-37-18-10-4-11-19-37/h2-21,24-31,42H,32-33H2,1H3 |
| InChIKey | WLJCGVRRJPGIGR-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|