About 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride
2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride (PubChem CID 50944318) has the molecular formula C9H20Cl2N4O2
and a molecular weight of 287.19 g/mol. Its IUPAC name is 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride |
| PubChem CID | 50944318 |
| Molecular Formula | C9H20Cl2N4O2 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride |
| SMILES | CN(C)C1=NC2(CCNCC2)C(=O)N1.Cl.Cl.O |
| InChI | InChI=1S/C9H16N4O.2ClH.H2O/c1-13(2)8-11-7(14)9(12-8)3-5-10-6-4-9;;;/h10H,3-6H2,1-2H3,(H,11,12,14);2*1H;1H2 |
| InChIKey | PSXJFINVJBELHQ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride?
The IUPAC name of 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride (CID 50944318) is 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride.
What is the SMILES notation for 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride?
The canonical SMILES for 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride is CN(C)C1=NC2(CCNCC2)C(=O)N1.Cl.Cl.O.
What is the InChIKey of 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride?
The InChIKey is PSXJFINVJBELHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O.2ClH.H2O/c1-13(2)8-11-7(14)9(12-8)3-5-10-6-4-9;;;/h10H,3-6H2,1-2H3,(H,11,12,14);2*1H;1H2.
What are the key properties of 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride?
2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride has a molecular weight of 287.19 g/mol, XLogP of -0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrate;dihydrochloride is sourced from PubChem (CID 50944318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).