C23H29NO2 — CID 50949878
N-[(2S,4R,6R)-2-benzhydryl-6-propan-2-yloxan-4-yl]acetamide (PubChem CID 50949878) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[(2S,4R,6R)-2-benzhydryl-6-propan-2-yloxan-4-yl]acetamide.
| Compound Name | N-[(2S,4R,6R)-2-benzhydryl-6-propan-2-yloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 50949878 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[(2S,4R,6R)-2-benzhydryl-6-propan-2-yloxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@@H](C(c2ccccc2)c2ccccc2)O[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C23H29NO2/c1-16(2)21-14-20(24-17(3)25)15-22(26-21)23(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,16,20-23H,14-15H2,1-3H3,(H,24,25)/t20-,21-,22+/m1/s1 |
| InChIKey | BQQAKSJUZAPKPV-VSKRKVRLSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |