C16H22N2O4S — CID 50955316
2-[(6,8-dimethyl-2-oxochromen-4-yl)methylamino]-N,N-dimethylethanesulfonamide (PubChem CID 50955316) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[(6,8-dimethyl-2-oxochromen-4-yl)methylamino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(6,8-dimethyl-2-oxochromen-4-yl)methylamino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 50955316 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[(6,8-dimethyl-2-oxochromen-4-yl)methylamino]-N,N-dimethylethanesulfonamide |
| SMILES | Cc1cc(C)c2oc(=O)cc(CNCCS(=O)(=O)N(C)C)c2c1 |
| InChI | InChI=1S/C16H22N2O4S/c1-11-7-12(2)16-14(8-11)13(9-15(19)22-16)10-17-5-6-23(20,21)18(3)4/h7-9,17H,5-6,10H2,1-4H3 |
| InChIKey | FQRQPZPBVWXVOH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|