C15H22N2O6 — CID 50956090
N'-(2,3-dihydroxypropyl)-N-(2,4-dimethoxyphenyl)-N'-methylpropanediamide (PubChem CID 50956090) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is N'-(2,3-dihydroxypropyl)-N-(2,4-dimethoxyphenyl)-N'-methylpropanediamide.
| Compound Name | N'-(2,3-dihydroxypropyl)-N-(2,4-dimethoxyphenyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 50956090 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N'-(2,3-dihydroxypropyl)-N-(2,4-dimethoxyphenyl)-N'-methylpropanediamide |
| SMILES | COc1ccc(NC(=O)CC(=O)N(C)CC(O)CO)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O6/c1-17(8-10(19)9-18)15(21)7-14(20)16-12-5-4-11(22-2)6-13(12)23-3/h4-6,10,18-19H,7-9H2,1-3H3,(H,16,20) |
| InChIKey | UMBMMAHTOBENKT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|