C16H12N6S — CID 50956899
4-(5-cyclopropyl-2-quinolin-8-yl-1,2,4-triazol-3-yl)thiadiazole (PubChem CID 50956899) has the molecular formula C16H12N6S and a molecular weight of 320.38 g/mol. Its IUPAC name is 4-(5-cyclopropyl-2-quinolin-8-yl-1,2,4-triazol-3-yl)thiadiazole.
| Compound Name | 4-(5-cyclopropyl-2-quinolin-8-yl-1,2,4-triazol-3-yl)thiadiazole |
|---|---|
| PubChem CID | 50956899 |
| Molecular Formula | C16H12N6S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-(5-cyclopropyl-2-quinolin-8-yl-1,2,4-triazol-3-yl)thiadiazole |
| SMILES | c1cnc2c(-n3nc(C4CC4)nc3-c3csnn3)cccc2c1 |
| InChI | InChI=1S/C16H12N6S/c1-3-10-4-2-8-17-14(10)13(5-1)22-16(12-9-23-21-19-12)18-15(20-22)11-6-7-11/h1-5,8-9,11H,6-7H2 |
| InChIKey | WFKAPSDDDBWJRC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |