C22H26N2O — CID 50969859
[(1S,3S,3aR,6aS)-1-(3-ethenylphenyl)-5-methyl-3-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol (PubChem CID 50969859) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is [(1S,3S,3aR,6aS)-1-(3-ethenylphenyl)-5-methyl-3-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol.
| Compound Name | [(1S,3S,3aR,6aS)-1-(3-ethenylphenyl)-5-methyl-3-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 50969859 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [(1S,3S,3aR,6aS)-1-(3-ethenylphenyl)-5-methyl-3-phenyl-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-yl]methanol |
| SMILES | C=Cc1cccc([C@H]2N[C@](CO)(c3ccccc3)[C@H]3CN(C)C[C@@H]23)c1 |
| InChI | InChI=1S/C22H26N2O/c1-3-16-8-7-9-17(12-16)21-19-13-24(2)14-20(19)22(15-25,23-21)18-10-5-4-6-11-18/h3-12,19-21,23,25H,1,13-15H2,2H3/t19-,20+,21-,22-/m1/s1 |
| InChIKey | KIHLFSYUGJGAFS-CIAFKFPVSA-N |
| XLogP | 3.04 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |