C15H19N5O4 — CID 50971628
N-(2,4-dimethoxyphenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanediamide (PubChem CID 50971628) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanediamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanediamide |
|---|---|
| PubChem CID | 50971628 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N'-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanediamide |
| SMILES | COc1ccc(NC(=O)CC(=O)NC(C)c2ncn[nH]2)c(OC)c1 |
| InChI | InChI=1S/C15H19N5O4/c1-9(15-16-8-17-20-15)18-13(21)7-14(22)19-11-5-4-10(23-2)6-12(11)24-3/h4-6,8-9H,7H2,1-3H3,(H,18,21)(H,19,22)(H,16,17,20) |
| InChIKey | QMOMHKDNKBPYMK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|