C18H27NO3 — CID 50972297
4-[[(2R,5S)-5-[(3-ethoxyphenyl)methyl]oxolan-2-yl]methyl]morpholine (PubChem CID 50972297) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[[(2R,5S)-5-[(3-ethoxyphenyl)methyl]oxolan-2-yl]methyl]morpholine.
| Compound Name | 4-[[(2R,5S)-5-[(3-ethoxyphenyl)methyl]oxolan-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 50972297 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 4-[[(2R,5S)-5-[(3-ethoxyphenyl)methyl]oxolan-2-yl]methyl]morpholine |
| SMILES | CCOc1cccc(C[C@@H]2CC[C@H](CN3CCOCC3)O2)c1 |
| InChI | InChI=1S/C18H27NO3/c1-2-21-16-5-3-4-15(12-16)13-17-6-7-18(22-17)14-19-8-10-20-11-9-19/h3-5,12,17-18H,2,6-11,13-14H2,1H3/t17-,18+/m0/s1 |
| InChIKey | ZCZYKOFLZOUAGT-ZWKOTPCHSA-N |
| XLogP | 2.51 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |