C17H19N5OS — CID 50975075
N-(2-pyridin-3-yloxypropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 50975075) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is N-(2-pyridin-3-yloxypropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N-(2-pyridin-3-yloxypropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 50975075 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(2-pyridin-3-yloxypropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CC(CNc1ncnc2sc3c(c12)CCNC3)Oc1cccnc1 |
| InChI | InChI=1S/C17H19N5OS/c1-11(23-12-3-2-5-18-8-12)7-20-16-15-13-4-6-19-9-14(13)24-17(15)22-10-21-16/h2-3,5,8,10-11,19H,4,6-7,9H2,1H3,(H,20,21,22) |
| InChIKey | JVXICDDJKHAXPO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |