C15H21N5O2S2 — CID 50965622
N-(2-pyrrolidin-1-ylsulfonylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 50965622) has the molecular formula C15H21N5O2S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylsulfonylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N-(2-pyrrolidin-1-ylsulfonylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 50965622 |
| Molecular Formula | C15H21N5O2S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(2-pyrrolidin-1-ylsulfonylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | O=S(=O)(CCNc1ncnc2sc3c(c12)CCNC3)N1CCCC1 |
| InChI | InChI=1S/C15H21N5O2S2/c21-24(22,20-6-1-2-7-20)8-5-17-14-13-11-3-4-16-9-12(11)23-15(13)19-10-18-14/h10,16H,1-9H2,(H,17,18,19) |
| InChIKey | UFXVBWLIZOMOPB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |