C19H24Cl2N4OS — CID 154889438
N-[2-(2-ethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine;dihydrochloride (PubChem CID 154889438) has the molecular formula C19H24Cl2N4OS and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[2-(2-ethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine;dihydrochloride.
| Compound Name | N-[2-(2-ethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 154889438 |
| Molecular Formula | C19H24Cl2N4OS |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[2-(2-ethoxyphenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine;dihydrochloride |
| SMILES | CCOc1ccccc1CCNc1ncnc2sc3c(c12)CCNC3.Cl.Cl |
| InChI | InChI=1S/C19H22N4OS.2ClH/c1-2-24-15-6-4-3-5-13(15)7-10-21-18-17-14-8-9-20-11-16(14)25-19(17)23-12-22-18;;/h3-6,12,20H,2,7-11H2,1H3,(H,21,22,23);2*1H |
| InChIKey | AOTBQFVPKXOSOB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |