C15H18Cl2N6O2S — CID 154886213
5-[2-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)ethyl]-1H-pyrimidine-2,4-dione;dihydrochloride (PubChem CID 154886213) has the molecular formula C15H18Cl2N6O2S and a molecular weight of 417.32 g/mol. Its IUPAC name is 5-[2-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)ethyl]-1H-pyrimidine-2,4-dione;dihydrochloride.
| Compound Name | 5-[2-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)ethyl]-1H-pyrimidine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 154886213 |
| Molecular Formula | C15H18Cl2N6O2S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 5-[2-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)ethyl]-1H-pyrimidine-2,4-dione;dihydrochloride |
| SMILES | Cl.Cl.O=c1[nH]cc(CCNc2ncnc3sc4c(c23)CCNC4)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N6O2S.2ClH/c22-13-8(5-18-15(23)21-13)1-4-17-12-11-9-2-3-16-6-10(9)24-14(11)20-7-19-12;;/h5,7,16H,1-4,6H2,(H,17,19,20)(H2,18,21,22,23);2*1H |
| InChIKey | NCCSONRNFKFOAZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |