C16H18N6S — CID 50961788
N-pyridin-3-yl-N'-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)ethane-1,2-diamine (PubChem CID 50961788) has the molecular formula C16H18N6S and a molecular weight of 326.43 g/mol. Its IUPAC name is N-pyridin-3-yl-N'-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)ethane-1,2-diamine.
| Compound Name | N-pyridin-3-yl-N'-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 50961788 |
| Molecular Formula | C16H18N6S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-pyridin-3-yl-N'-(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)ethane-1,2-diamine |
| SMILES | c1cncc(NCCNc2ncnc3sc4c(c23)CCNC4)c1 |
| InChI | InChI=1S/C16H18N6S/c1-2-11(8-17-4-1)19-6-7-20-15-14-12-3-5-18-9-13(12)23-16(14)22-10-21-15/h1-2,4,8,10,18-19H,3,5-7,9H2,(H,20,21,22) |
| InChIKey | OAOOZANDMBKDMA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|