C15H20N4O3 — CID 50976612
methyl 6-[(9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylate (PubChem CID 50976612) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl 6-[(9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[(9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 50976612 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl 6-[(9-oxo-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CN2CCN3CCNC(=O)C3C2)n1 |
| InChI | InChI=1S/C15H20N4O3/c1-22-15(21)12-4-2-3-11(17-12)9-18-7-8-19-6-5-16-14(20)13(19)10-18/h2-4,13H,5-10H2,1H3,(H,16,20) |
| InChIKey | MPYAQOSIXVIIHC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |