C18H27N5O2 — CID 50979830
(3aR,6aR)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50979830) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (3aR,6aR)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50979830 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (3aR,6aR)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C(NCC1(CO)CCCC1)[C@@]12CNC[C@@H]1CN(c1ncccn1)C2 |
| InChI | InChI=1S/C18H27N5O2/c24-13-17(4-1-2-5-17)10-22-15(25)18-11-19-8-14(18)9-23(12-18)16-20-6-3-7-21-16/h3,6-7,14,19,24H,1-2,4-5,8-13H2,(H,22,25)/t14-,18-/m1/s1 |
| InChIKey | FJUFBEFIAPMPQG-RDTXWAMCSA-N |
| XLogP | 0.17 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |