C17H25N5O2S — CID 50951499
(3aR,6aR)-5-cyclopentyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50951499) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is (3aR,6aR)-5-cyclopentyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-5-cyclopentyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50951499 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (3aR,6aR)-5-cyclopentyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C(CNC(=O)[C@@]12CNC[C@@H]1CN(C1CCCC1)C2)Nc1nccs1 |
| InChI | InChI=1S/C17H25N5O2S/c23-14(21-16-19-5-6-25-16)8-20-15(24)17-10-18-7-12(17)9-22(11-17)13-3-1-2-4-13/h5-6,12-13,18H,1-4,7-11H2,(H,20,24)(H,19,21,23)/t12-,17-/m1/s1 |
| InChIKey | PTFUMEKLKJBUNZ-SJKOYZFVSA-N |
| XLogP | 0.66 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |