C16H17N3O2 — CID 50985062
N-butyl-6-cyano-N-(furan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 50985062) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-butyl-6-cyano-N-(furan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | N-butyl-6-cyano-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50985062 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-butyl-6-cyano-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | CCCCN(Cc1ccco1)C(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C16H17N3O2/c1-2-3-8-19(12-15-5-4-9-21-15)16(20)13-6-7-14(10-17)18-11-13/h4-7,9,11H,2-3,8,12H2,1H3 |
| InChIKey | QKZKOUCEQGRMLE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |