C6H8N2OS — CID 50988284
2-(azetidin-3-yloxy)-1,3-thiazole (PubChem CID 50988284) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-(azetidin-3-yloxy)-1,3-thiazole.
| Compound Name | 2-(azetidin-3-yloxy)-1,3-thiazole |
|---|---|
| PubChem CID | 50988284 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-(azetidin-3-yloxy)-1,3-thiazole |
| SMILES | c1csc(OC2CNC2)n1 |
| InChI | InChI=1S/C6H8N2OS/c1-2-10-6(8-1)9-5-3-7-4-5/h1-2,5,7H,3-4H2 |
| InChIKey | YIOXSECGDVLEBV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |