C15H19ClN4OS2 — CID 509942
5-chloro-N-[5-(2-phenylsulfanylethylamino)-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 509942) has the molecular formula C15H19ClN4OS2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 5-chloro-N-[5-(2-phenylsulfanylethylamino)-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | 5-chloro-N-[5-(2-phenylsulfanylethylamino)-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 509942 |
| Molecular Formula | C15H19ClN4OS2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 5-chloro-N-[5-(2-phenylsulfanylethylamino)-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | O=C(CCCCCl)Nc1nnc(NCCSc2ccccc2)s1 |
| InChI | InChI=1S/C15H19ClN4OS2/c16-9-5-4-8-13(21)18-15-20-19-14(23-15)17-10-11-22-12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2,(H,17,19)(H,18,20,21) |
| InChIKey | MBHZPNHFEODMIP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|