C34H43N4O7P — CID 51002836
dibenzyl [4-[(2S)-2-(butanoylamino)-3-oxo-3-[3-(2-oxo-1,3-diazinan-1-yl)propylamino]propyl]phenyl] phosphate (PubChem CID 51002836) has the molecular formula C34H43N4O7P and a molecular weight of 650.71 g/mol. Its IUPAC name is dibenzyl [4-[(2S)-2-(butanoylamino)-3-oxo-3-[3-(2-oxo-1,3-diazinan-1-yl)propylamino]propyl]phenyl] phosphate.
| Compound Name | dibenzyl [4-[(2S)-2-(butanoylamino)-3-oxo-3-[3-(2-oxo-1,3-diazinan-1-yl)propylamino]propyl]phenyl] phosphate |
|---|---|
| PubChem CID | 51002836 |
| Molecular Formula | C34H43N4O7P |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | dibenzyl [4-[(2S)-2-(butanoylamino)-3-oxo-3-[3-(2-oxo-1,3-diazinan-1-yl)propylamino]propyl]phenyl] phosphate |
| SMILES | CCCC(=O)N[C@@H](Cc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)cc1)C(=O)NCCCN1CCCNC1=O |
| InChI | InChI=1S/C34H43N4O7P/c1-2-11-32(39)37-31(33(40)35-20-9-22-38-23-10-21-36-34(38)41)24-27-16-18-30(19-17-27)45-46(42,43-25-28-12-5-3-6-13-28)44-26-29-14-7-4-8-15-29/h3-8,12-19,31H,2,9-11,20-26H2,1H3,(H,35,40)(H,36,41)(H,37,39)/t31-/m0/s1 |
| InChIKey | NURIFPWINRJRMW-HKBQPEDESA-N |
| XLogP | 5.36 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|