C17H21ClN2O4S — CID 51003611
3-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide (PubChem CID 51003611) has the molecular formula C17H21ClN2O4S and a molecular weight of 384.89 g/mol. Its IUPAC name is 3-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide.
| Compound Name | 3-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 51003611 |
| Molecular Formula | C17H21ClN2O4S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 3-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCNC(=O)/C=C/c1cccc(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21ClN2O4S/c1-20(15-8-10-25(23,24)12-15)17(22)7-9-19-16(21)6-5-13-3-2-4-14(18)11-13/h2-6,11,15H,7-10,12H2,1H3,(H,19,21)/b6-5+ |
| InChIKey | VCUSHPMBOUAOFU-AATRIKPKSA-N |
| XLogP | 1.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|