C32H43NO3 — CID 51003617
cyclopentyl-[4-[3-[4-(cyclopentyl-hydroxy-phenylmethyl)piperidin-1-yl]propoxy]phenyl]methanone (PubChem CID 51003617) has the molecular formula C32H43NO3 and a molecular weight of 489.70 g/mol. Its IUPAC name is cyclopentyl-[4-[3-[4-(cyclopentyl-hydroxy-phenylmethyl)piperidin-1-yl]propoxy]phenyl]methanone.
| Compound Name | cyclopentyl-[4-[3-[4-(cyclopentyl-hydroxy-phenylmethyl)piperidin-1-yl]propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 51003617 |
| Molecular Formula | C32H43NO3 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | cyclopentyl-[4-[3-[4-(cyclopentyl-hydroxy-phenylmethyl)piperidin-1-yl]propoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCCCN2CCC(C(O)(c3ccccc3)C3CCCC3)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C32H43NO3/c34-31(25-9-4-5-10-25)26-15-17-30(18-16-26)36-24-8-21-33-22-19-29(20-23-33)32(35,28-13-6-7-14-28)27-11-2-1-3-12-27/h1-3,11-12,15-18,25,28-29,35H,4-10,13-14,19-24H2 |
| InChIKey | LLIDQVZZWRGCJP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|