C13H13NO4 — CID 51015231
(1R,9R,12R)-10-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylic acid (PubChem CID 51015231) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (1R,9R,12R)-10-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylic acid.
| Compound Name | (1R,9R,12R)-10-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylic acid |
|---|---|
| PubChem CID | 51015231 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (1R,9R,12R)-10-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylic acid |
| SMILES | CN1C(=O)[C@H](C(=O)O)[C@H]2C[C@H]1Oc1ccccc12 |
| InChI | InChI=1S/C13H13NO4/c1-14-10-6-8(11(12(14)15)13(16)17)7-4-2-3-5-9(7)18-10/h2-5,8,10-11H,6H2,1H3,(H,16,17)/t8-,10+,11+/m0/s1 |
| InChIKey | HBESDSVSEHUBNQ-JMJZKYOTSA-N |
| XLogP | 1.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|