C23H26ClNO6 — CID 510324
1-adamantyl N-[4-chloro-3-(2-methoxyethoxy)-1-oxoisochromen-7-yl]carbamate (PubChem CID 510324) has the molecular formula C23H26ClNO6 and a molecular weight of 447.92 g/mol. Its IUPAC name is 1-adamantyl N-[4-chloro-3-(2-methoxyethoxy)-1-oxoisochromen-7-yl]carbamate.
| Compound Name | 1-adamantyl N-[4-chloro-3-(2-methoxyethoxy)-1-oxoisochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 510324 |
| Molecular Formula | C23H26ClNO6 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-adamantyl N-[4-chloro-3-(2-methoxyethoxy)-1-oxoisochromen-7-yl]carbamate |
| SMILES | COCCOc1oc(=O)c2cc(NC(=O)OC34CC5CC(CC(C5)C3)C4)ccc2c1Cl |
| InChI | InChI=1S/C23H26ClNO6/c1-28-4-5-29-21-19(24)17-3-2-16(9-18(17)20(26)30-21)25-22(27)31-23-10-13-6-14(11-23)8-15(7-13)12-23/h2-3,9,13-15H,4-8,10-12H2,1H3,(H,25,27) |
| InChIKey | JIAVLGFMUYQUCD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|