C16H22N2O4S — CID 51032453
(3aS,7aS)-1-(4-methylphenyl)sulfonyl-2-(nitromethyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 51032453) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is (3aS,7aS)-1-(4-methylphenyl)sulfonyl-2-(nitromethyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | (3aS,7aS)-1-(4-methylphenyl)sulfonyl-2-(nitromethyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 51032453 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (3aS,7aS)-1-(4-methylphenyl)sulfonyl-2-(nitromethyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C[N+](=O)[O-])C[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-12-6-8-15(9-7-12)23(21,22)18-14(11-17(19)20)10-13-4-2-3-5-16(13)18/h6-9,13-14,16H,2-5,10-11H2,1H3/t13-,14?,16-/m0/s1 |
| InChIKey | FKKMPVGRQGMOHO-SFIRGFGWSA-N |
| XLogP | 2.59 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|