C11H14F3N3O3S — CID 5103390
methyl 3,3,3-trifluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-(propanoylamino)propanoate (PubChem CID 5103390) has the molecular formula C11H14F3N3O3S and a molecular weight of 325.31 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-(propanoylamino)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 5103390 |
| Molecular Formula | C11H14F3N3O3S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-(propanoylamino)propanoate |
| SMILES | CCC(=O)NC(Nc1ncc(C)s1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O3S/c1-4-7(18)16-10(8(19)20-3,11(12,13)14)17-9-15-5-6(2)21-9/h5H,4H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | ISFOVPKSDHNHOV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|