C26H22F2N4O5S — CID 51041353
4-[[7-[3-fluoro-4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid (PubChem CID 51041353) has the molecular formula C26H22F2N4O5S and a molecular weight of 540.55 g/mol. Its IUPAC name is 4-[[7-[3-fluoro-4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[7-[3-fluoro-4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 51041353 |
| Molecular Formula | C26H22F2N4O5S |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 4-[[7-[3-fluoro-4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(Oc3ccnc4cc(C(=O)NCCCC(=O)O)sc34)cc2F)c1 |
| InChI | InChI=1S/C26H22F2N4O5S/c1-14-4-6-16(27)19(11-14)32-26(36)31-18-7-5-15(12-17(18)28)37-21-8-10-29-20-13-22(38-24(20)21)25(35)30-9-2-3-23(33)34/h4-8,10-13H,2-3,9H2,1H3,(H,30,35)(H,33,34)(H2,31,32,36) |
| InChIKey | DFTANXXGINSIBO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|