C8H4F3N5OS — CID 51043868
2-methyl-4-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-oxazole (PubChem CID 51043868) has the molecular formula C8H4F3N5OS and a molecular weight of 275.22 g/mol. Its IUPAC name is 2-methyl-4-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-oxazole.
| Compound Name | 2-methyl-4-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 51043868 |
| Molecular Formula | C8H4F3N5OS |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 2-methyl-4-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-oxazole |
| SMILES | Cc1nc(-c2nn3c(C(F)(F)F)nnc3s2)co1 |
| InChI | InChI=1S/C8H4F3N5OS/c1-3-12-4(2-17-3)5-15-16-6(8(9,10)11)13-14-7(16)18-5/h2H,1H3 |
| InChIKey | CEZBFLFIWXUWJT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |