C15H11F3N6S — CID 51052834
6-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 51052834) has the molecular formula C15H11F3N6S and a molecular weight of 364.36 g/mol. Its IUPAC name is 6-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 51052834 |
| Molecular Formula | C15H11F3N6S |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 6-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cc(C)n(-c2cccc(-c3nn4c(C(F)(F)F)nnc4s3)c2)n1 |
| InChI | InChI=1S/C15H11F3N6S/c1-8-6-9(2)23(21-8)11-5-3-4-10(7-11)12-22-24-13(15(16,17)18)19-20-14(24)25-12/h3-7H,1-2H3 |
| InChIKey | LHDPYSIOKMEBND-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |