C14H12ClN3O3 — CID 51044918
N-[(3-chlorophenyl)methyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide (PubChem CID 51044918) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide |
|---|---|
| PubChem CID | 51044918 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)C(=O)Nc1c[nH]ccc1=O |
| InChI | InChI=1S/C14H12ClN3O3/c15-10-3-1-2-9(6-10)7-17-13(20)14(21)18-11-8-16-5-4-12(11)19/h1-6,8H,7H2,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | MXLVAMRHASRZBB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|