C22H18N2O8S2 — CID 51056680
(6-morpholin-4-ylsulfonyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate (PubChem CID 51056680) has the molecular formula C22H18N2O8S2 and a molecular weight of 502.53 g/mol. Its IUPAC name is (6-morpholin-4-ylsulfonyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate.
| Compound Name | (6-morpholin-4-ylsulfonyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate |
|---|---|
| PubChem CID | 51056680 |
| Molecular Formula | C22H18N2O8S2 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | (6-morpholin-4-ylsulfonyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate |
| SMILES | O=C1c2cccc3c(S(=O)(=O)N4CCOCC4)ccc(c23)C(=O)N1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O8S2/c25-21-17-8-4-7-16-19(33(27,28)23-11-13-31-14-12-23)10-9-18(20(16)17)22(26)24(21)32-34(29,30)15-5-2-1-3-6-15/h1-10H,11-14H2 |
| InChIKey | QSEFNMLCNXVMHI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|