C27H32N3O3S+ — CID 58705035
N,N-diethyl-4-(1-ethyl-6-morpholin-4-ylsulfonylbenzo[cd]indol-1-ium-2-yl)aniline (PubChem CID 58705035) has the molecular formula C27H32N3O3S+ and a molecular weight of 478.64 g/mol. Its IUPAC name is N,N-diethyl-4-(1-ethyl-6-morpholin-4-ylsulfonylbenzo[cd]indol-1-ium-2-yl)aniline.
| Compound Name | N,N-diethyl-4-(1-ethyl-6-morpholin-4-ylsulfonylbenzo[cd]indol-1-ium-2-yl)aniline |
|---|---|
| PubChem CID | 58705035 |
| Molecular Formula | C27H32N3O3S+ |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N,N-diethyl-4-(1-ethyl-6-morpholin-4-ylsulfonylbenzo[cd]indol-1-ium-2-yl)aniline |
| SMILES | CCN(CC)c1ccc(C2=[N+](CC)c3ccc(S(=O)(=O)N4CCOCC4)c4cccc2c34)cc1 |
| InChI | InChI=1S/C27H32N3O3S/c1-4-28(5-2)21-12-10-20(11-13-21)27-23-9-7-8-22-25(15-14-24(26(22)23)30(27)6-3)34(31,32)29-16-18-33-19-17-29/h7-15H,4-6,16-19H2,1-3H3/q+1 |
| InChIKey | QAXBTXSISLNTGW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|