C14H16N4O4S — CID 51063117
hydrogen sulfate;[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]iminoazanium (PubChem CID 51063117) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is hydrogen sulfate;[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]iminoazanium.
| Compound Name | hydrogen sulfate;[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]iminoazanium |
|---|---|
| PubChem CID | 51063117 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | hydrogen sulfate;[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]iminoazanium |
| SMILES | Cc1cc(/N=N/c2ccccc2C)ccc1N=[NH2+].O=S(=O)([O-])O |
| InChI | InChI=1S/C14H14N4.H2O4S/c1-10-5-3-4-6-14(10)18-17-12-7-8-13(16-15)11(2)9-12;1-5(2,3)4/h3-9,15H,1-2H3;(H2,1,2,3,4)/b16-15?,18-17+; |
| InChIKey | RMCYHSUNJZUSSI-PQVRIMNQSA-N |
| XLogP | 2.57 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|