C16H15N3O — CID 51063172
6-methyl-3-phenyl-6-pyridin-4-yl-1,2-dihydropyrazin-5-one (PubChem CID 51063172) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-methyl-3-phenyl-6-pyridin-4-yl-1,2-dihydropyrazin-5-one.
| Compound Name | 6-methyl-3-phenyl-6-pyridin-4-yl-1,2-dihydropyrazin-5-one |
|---|---|
| PubChem CID | 51063172 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 6-methyl-3-phenyl-6-pyridin-4-yl-1,2-dihydropyrazin-5-one |
| SMILES | CC1(c2ccncc2)NCC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C16H15N3O/c1-16(13-7-9-17-10-8-13)15(20)19-14(11-18-16)12-5-3-2-4-6-12/h2-10,18H,11H2,1H3 |
| InChIKey | KHCPTKOHTGITSZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |