C16H16N4O2 — CID 51064344
(E)-N-(benzotriazol-1-ylmethyl)-1-(3,4-dimethoxyphenyl)methanimine (PubChem CID 51064344) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is (E)-N-(benzotriazol-1-ylmethyl)-1-(3,4-dimethoxyphenyl)methanimine.
| Compound Name | (E)-N-(benzotriazol-1-ylmethyl)-1-(3,4-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 51064344 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (E)-N-(benzotriazol-1-ylmethyl)-1-(3,4-dimethoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/Cn2nnc3ccccc32)cc1OC |
| InChI | InChI=1S/C16H16N4O2/c1-21-15-8-7-12(9-16(15)22-2)10-17-11-20-14-6-4-3-5-13(14)18-19-20/h3-10H,11H2,1-2H3/b17-10+ |
| InChIKey | JTDBZECTYHEMIA-LICLKQGHSA-N |
| XLogP | 2.53 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|