C18H20N2O3 — CID 51088901
4-acetyl-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 51088901) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-acetyl-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51088901 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-acetyl-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)NCCOc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-12(21)15-10-17(20-11-15)18(22)19-7-8-23-16-6-5-13-3-2-4-14(13)9-16/h5-6,9-11,20H,2-4,7-8H2,1H3,(H,19,22) |
| InChIKey | HZVYCPOUYPZCRD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|