C34H40IN3O7 — CID 5109089
3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hept-6-enoyl-[2-(1H-indol-2-yl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 5109089) has the molecular formula C34H40IN3O7 and a molecular weight of 729.61 g/mol. Its IUPAC name is 3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hept-6-enoyl-[2-(1H-indol-2-yl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hept-6-enoyl-[2-(1H-indol-2-yl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 5109089 |
| Molecular Formula | C34H40IN3O7 |
| Molecular Weight | 729.61 g/mol |
| Exact Mass | 729.19 |
| IUPAC Name | 3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hept-6-enoyl-[2-(1H-indol-2-yl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | C=CCCCCC(=O)N(CCc1cc2ccccc2[nH]1)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C34H40IN3O7/c1-3-4-5-6-11-31(41)38(14-12-25-18-23-9-7-8-10-27(23)37-25)28-19-24(34(43)36-13-15-39)20-29(32(28)42)45-33-26(35)16-22(21-40)17-30(33)44-2/h3,7-10,16-18,20-21,28-29,32,37,39,42H,1,4-6,11-15,19H2,2H3,(H,36,43) |
| InChIKey | HZVWCSPJAPTRKR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|