C17H24N4O4 — CID 51094075
2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide (PubChem CID 51094075) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 51094075 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)CN1CCN(C(=O)Cc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C17H24N4O4/c1-18-17(24)19-15(22)12-20-6-8-21(9-7-20)16(23)11-13-4-3-5-14(10-13)25-2/h3-5,10H,6-9,11-12H2,1-2H3,(H2,18,19,22,24) |
| InChIKey | OOPJAZMMOGFIFK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |