C16H20N6O — CID 51095520
N,N-bis(2-cyanoethyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide (PubChem CID 51095520) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide.
| Compound Name | N,N-bis(2-cyanoethyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51095520 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-1-pyrimidin-2-ylpiperidine-4-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H20N6O/c17-6-1-10-21(11-2-7-18)15(23)14-4-12-22(13-5-14)16-19-8-3-9-20-16/h3,8-9,14H,1-2,4-5,10-13H2 |
| InChIKey | BFDQFJSBPVREDL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |