C13H15ClN2O4S — CID 51107312
methyl 3-chloro-4-[2-cyanopropyl(methyl)sulfamoyl]benzoate (PubChem CID 51107312) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is methyl 3-chloro-4-[2-cyanopropyl(methyl)sulfamoyl]benzoate.
| Compound Name | methyl 3-chloro-4-[2-cyanopropyl(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 51107312 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | methyl 3-chloro-4-[2-cyanopropyl(methyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(C)CC(C)C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2O4S/c1-9(7-15)8-16(2)21(18,19)12-5-4-10(6-11(12)14)13(17)20-3/h4-6,9H,8H2,1-3H3 |
| InChIKey | KFFLQELHQQPHJX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |