C16H22ClNO5S — CID 99802892
methyl 3-chloro-4-[cyclobutylmethyl-[(2R)-1-hydroxypropan-2-yl]sulfamoyl]benzoate (PubChem CID 99802892) has the molecular formula C16H22ClNO5S and a molecular weight of 375.87 g/mol. Its IUPAC name is methyl 3-chloro-4-[cyclobutylmethyl-[(2R)-1-hydroxypropan-2-yl]sulfamoyl]benzoate.
| Compound Name | methyl 3-chloro-4-[cyclobutylmethyl-[(2R)-1-hydroxypropan-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 99802892 |
| Molecular Formula | C16H22ClNO5S |
| Molecular Weight | 375.87 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl 3-chloro-4-[cyclobutylmethyl-[(2R)-1-hydroxypropan-2-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(CC2CCC2)[C@H](C)CO)c(Cl)c1 |
| InChI | InChI=1S/C16H22ClNO5S/c1-11(10-19)18(9-12-4-3-5-12)24(21,22)15-7-6-13(8-14(15)17)16(20)23-2/h6-8,11-12,19H,3-5,9-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZCYNCWFXPRWSLN-LLVKDONJSA-N |
| XLogP | 2.30 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.87 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |