C19H14N4O3S — CID 51115910
N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 51115910) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 51115910 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[4-(2-methyl-1,3-oxazol-5-yl)phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | Cc1ncc(-c2ccc(NC(=O)c3ccc4c(=O)[nH]c(=S)[nH]c4c3)cc2)o1 |
| InChI | InChI=1S/C19H14N4O3S/c1-10-20-9-16(26-10)11-2-5-13(6-3-11)21-17(24)12-4-7-14-15(8-12)22-19(27)23-18(14)25/h2-9H,1H3,(H,21,24)(H2,22,23,25,27) |
| InChIKey | MJUDVSDSQKEZAY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|